About tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane
tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane (PubChem CID 159317062) has the molecular formula C19H42O8Si2
and a molecular weight of 454.71 g/mol. Its IUPAC name is tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane.
Molecular Properties
| Compound Name | tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
| PubChem CID | 159317062 |
| Molecular Formula | C19H42O8Si2 |
| Molecular Weight | 454.71 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
| SMILES | CCO[Si](OCC)(OCC)OCC.CO[Si](CCC1CCC2OC2C1)(OC)OC |
| InChI | InChI=1S/C11H22O4Si.C8H20O4Si/c1-12-16(13-2,14-3)7-6-9-4-5-10-11(8-9)15-10;1-5-9-13(10-6-2,11-7-3)12-8-4/h9-11H,4-8H2,1-3H3;5-8H2,1-4H3 |
| InChIKey | LDGSPFVNJAQTDO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.71 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane?
The IUPAC name of tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane (CID 159317062) is tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane.
What is the SMILES notation for tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane?
The canonical SMILES for tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane is CCO[Si](OCC)(OCC)OCC.CO[Si](CCC1CCC2OC2C1)(OC)OC.
What is the InChIKey of tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane?
The InChIKey is LDGSPFVNJAQTDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4Si.C8H20O4Si/c1-12-16(13-2,14-3)7-6-9-4-5-10-11(8-9)15-10;1-5-9-13(10-6-2,11-7-3)12-8-4/h9-11H,4-8H2,1-3H3;5-8H2,1-4H3.
What are the key properties of tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane?
tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane has a molecular weight of 454.71 g/mol, XLogP of 3.39, 14 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tetraethyl silicate;trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane is sourced from PubChem (CID 159317062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).