C31H31F4N5O3S — CID 159317785
2-(5-fluoro-2-methylphenyl)-2-[3-oxo-4-(5-piperazin-1-ylpent-1-ynyl)-1H-isoindol-2-yl]-N-(1,3-thiazol-2-yl)acetamide;2,2,2-trifluoroacetaldehyde (PubChem CID 159317785) has the molecular formula C31H31F4N5O3S and a molecular weight of 629.68 g/mol. Its IUPAC name is 2-(5-fluoro-2-methylphenyl)-2-[3-oxo-4-(5-piperazin-1-ylpent-1-ynyl)-1H-isoindol-2-yl]-N-(1,3-thiazol-2-yl)acetamide;2,2,2-trifluoroacetaldehyde.
| Compound Name | 2-(5-fluoro-2-methylphenyl)-2-[3-oxo-4-(5-piperazin-1-ylpent-1-ynyl)-1H-isoindol-2-yl]-N-(1,3-thiazol-2-yl)acetamide;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 159317785 |
| Molecular Formula | C31H31F4N5O3S |
| Molecular Weight | 629.68 g/mol |
| Exact Mass | 629.21 |
| IUPAC Name | 2-(5-fluoro-2-methylphenyl)-2-[3-oxo-4-(5-piperazin-1-ylpent-1-ynyl)-1H-isoindol-2-yl]-N-(1,3-thiazol-2-yl)acetamide;2,2,2-trifluoroacetaldehyde |
| SMILES | Cc1ccc(F)cc1C(C(=O)Nc1nccs1)N1Cc2cccc(C#CCCCN3CCNCC3)c2C1=O.O=CC(F)(F)F |
| InChI | InChI=1S/C29H30FN5O2S.C2HF3O/c1-20-9-10-23(30)18-24(20)26(27(36)33-29-32-13-17-38-29)35-19-22-8-5-7-21(25(22)28(35)37)6-3-2-4-14-34-15-11-31-12-16-34;3-2(4,5)1-6/h5,7-10,13,17-18,26,31H,2,4,11-12,14-16,19H2,1H3,(H,32,33,36);1H |
| InChIKey | LDJBDASFAVWRHA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|