C17H12BrF2NO2 — CID 159319343
1-[6-amino-5-bromo-2-(2,4-difluorophenyl)-1-benzofuran-3-yl]propan-1-one (PubChem CID 159319343) has the molecular formula C17H12BrF2NO2 and a molecular weight of 380.19 g/mol. Its IUPAC name is 1-[6-amino-5-bromo-2-(2,4-difluorophenyl)-1-benzofuran-3-yl]propan-1-one.
| Compound Name | 1-[6-amino-5-bromo-2-(2,4-difluorophenyl)-1-benzofuran-3-yl]propan-1-one |
|---|---|
| PubChem CID | 159319343 |
| Molecular Formula | C17H12BrF2NO2 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 1-[6-amino-5-bromo-2-(2,4-difluorophenyl)-1-benzofuran-3-yl]propan-1-one |
| SMILES | CCC(=O)c1c(-c2ccc(F)cc2F)oc2cc(N)c(Br)cc12 |
| InChI | InChI=1S/C17H12BrF2NO2/c1-2-14(22)16-10-6-11(18)13(21)7-15(10)23-17(16)9-4-3-8(19)5-12(9)20/h3-7H,2,21H2,1H3 |
| InChIKey | XETPTVIICUQUHJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|