C14H22ClN3O3 — CID 15932
diethyl-[4-(5-ethyl-2,4,6-trioxo-1,3-diazinan-5-yl)but-2-ynyl]azanium chloride (PubChem CID 15932) has the molecular formula C14H22ClN3O3 and a molecular weight of 315.80 g/mol. Its IUPAC name is diethyl-[4-(5-ethyl-2,4,6-trioxo-1,3-diazinan-5-yl)but-2-ynyl]azanium chloride.
| Compound Name | diethyl-[4-(5-ethyl-2,4,6-trioxo-1,3-diazinan-5-yl)but-2-ynyl]azanium chloride |
|---|---|
| PubChem CID | 15932 |
| Molecular Formula | C14H22ClN3O3 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | diethyl-[4-(5-ethyl-2,4,6-trioxo-1,3-diazinan-5-yl)but-2-ynyl]azanium chloride |
| SMILES | CC[NH+](CC)CC#CCC1(CC)C(=O)NC(=O)NC1=O.[Cl-] |
| InChI | InChI=1S/C14H21N3O3.ClH/c1-4-14(9-7-8-10-17(5-2)6-3)11(18)15-13(20)16-12(14)19;/h4-6,9-10H2,1-3H3,(H2,15,16,18,19,20);1H |
| InChIKey | XVOZTRVNPANHRB-UHFFFAOYSA-N |
| XLogP | -3.93 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|