About benzaldehyde;2-(methylamino)-2-phenylacetonitrile
benzaldehyde;2-(methylamino)-2-phenylacetonitrile (PubChem CID 159320881) has the molecular formula C16H16N2O
and a molecular weight of 252.32 g/mol. Its IUPAC name is benzaldehyde;2-(methylamino)-2-phenylacetonitrile.
Molecular Properties
| Compound Name | benzaldehyde;2-(methylamino)-2-phenylacetonitrile |
| PubChem CID | 159320881 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | benzaldehyde;2-(methylamino)-2-phenylacetonitrile |
| SMILES | CNC(C#N)c1ccccc1.O=Cc1ccccc1 |
| InChI | InChI=1S/C9H10N2.C7H6O/c1-11-9(7-10)8-5-3-2-4-6-8;8-6-7-4-2-1-3-5-7/h2-6,9,11H,1H3;1-6H |
| InChIKey | LDTBSGSOIKSTCD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;2-(methylamino)-2-phenylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;2-(methylamino)-2-phenylacetonitrile?
The IUPAC name of benzaldehyde;2-(methylamino)-2-phenylacetonitrile (CID 159320881) is benzaldehyde;2-(methylamino)-2-phenylacetonitrile.
What is the SMILES notation for benzaldehyde;2-(methylamino)-2-phenylacetonitrile?
The canonical SMILES for benzaldehyde;2-(methylamino)-2-phenylacetonitrile is CNC(C#N)c1ccccc1.O=Cc1ccccc1.
What is the InChIKey of benzaldehyde;2-(methylamino)-2-phenylacetonitrile?
The InChIKey is LDTBSGSOIKSTCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.C7H6O/c1-11-9(7-10)8-5-3-2-4-6-8;8-6-7-4-2-1-3-5-7/h2-6,9,11H,1H3;1-6H.
What are the key properties of benzaldehyde;2-(methylamino)-2-phenylacetonitrile?
benzaldehyde;2-(methylamino)-2-phenylacetonitrile has a molecular weight of 252.32 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;2-(methylamino)-2-phenylacetonitrile is sourced from PubChem (CID 159320881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).