C33H50N4O5 — CID 159322114
bis(5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane);3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 159322114) has the molecular formula C33H50N4O5 and a molecular weight of 582.79 g/mol. Its IUPAC name is bis(5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane);3,5,5-trimethylcyclohex-2-en-1-one.
| Compound Name | bis(5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane);3,5,5-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 159322114 |
| Molecular Formula | C33H50N4O5 |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.38 |
| IUPAC Name | bis(5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane);3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1.CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1.CC1=CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/2C12H18N2O2.C9H14O/c2*1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15;1-7-4-8(10)6-9(2,3)5-7/h2*10H,4-7H2,1-3H3;4H,5-6H2,1-3H3 |
| InChIKey | LDWYGXBMNNNIBD-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 134.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|