C22H26O4 — CID 159323188
1-[4-[3,4-bis(hydroxymethyl)benzoyl]phenyl]heptan-1-one (PubChem CID 159323188) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[4-[3,4-bis(hydroxymethyl)benzoyl]phenyl]heptan-1-one.
| Compound Name | 1-[4-[3,4-bis(hydroxymethyl)benzoyl]phenyl]heptan-1-one |
|---|---|
| PubChem CID | 159323188 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-[4-[3,4-bis(hydroxymethyl)benzoyl]phenyl]heptan-1-one |
| SMILES | CCCCCCC(=O)c1ccc(C(=O)c2ccc(CO)c(CO)c2)cc1 |
| InChI | InChI=1S/C22H26O4/c1-2-3-4-5-6-21(25)16-7-9-17(10-8-16)22(26)18-11-12-19(14-23)20(13-18)15-24/h7-13,23-24H,2-6,14-15H2,1H3 |
| InChIKey | OYIHQCUABHTZOF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|