About 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate
2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate (PubChem CID 159323323) has the molecular formula C16H18BrF3O4S
and a molecular weight of 443.28 g/mol. Its IUPAC name is 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate.
Molecular Properties
| Compound Name | 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate |
| PubChem CID | 159323323 |
| Molecular Formula | C16H18BrF3O4S |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate |
| SMILES | FC(F)(F)[s+]1c(C2CCCCCC2)cc2ccccc21.[O-][Br+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C16H18F3S.BrO4/c17-16(18,19)20-14-10-6-5-9-13(14)11-15(20)12-7-3-1-2-4-8-12;2-1(3,4)5/h5-6,9-12H,1-4,7-8H2;/q+1;-1 |
| InChIKey | WCBZOXBLRABWDC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate?
The IUPAC name of 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate (CID 159323323) is 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate.
What is the SMILES notation for 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate?
The canonical SMILES for 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate is FC(F)(F)[s+]1c(C2CCCCCC2)cc2ccccc21.[O-][Br+3]([O-])([O-])[O-].
What is the InChIKey of 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate?
The InChIKey is WCBZOXBLRABWDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F3S.BrO4/c17-16(18,19)20-14-10-6-5-9-13(14)11-15(20)12-7-3-1-2-4-8-12;2-1(3,4)5/h5-6,9-12H,1-4,7-8H2;/q+1;-1.
What are the key properties of 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate?
2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate has a molecular weight of 443.28 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium perbromate is sourced from PubChem (CID 159323323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).