About 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole
4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole (PubChem CID 159325263) has the molecular formula C9H4Br3N3S3
and a molecular weight of 490.07 g/mol. Its IUPAC name is 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole.
Molecular Properties
| Compound Name | 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole |
| PubChem CID | 159325263 |
| Molecular Formula | C9H4Br3N3S3 |
| Molecular Weight | 490.07 g/mol |
| Exact Mass | 486.71 |
| IUPAC Name | 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole |
| SMILES | Brc1cscn1.Brc1ncsc1-c1scnc1Br |
| InChI | InChI=1S/C6H2Br2N2S2.C3H2BrNS/c7-5-3(11-1-9-5)4-6(8)10-2-12-4;4-3-1-6-2-5-3/h1-2H;1-2H |
| InChIKey | LEGWMPSPXDSQQW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.07 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole?
The IUPAC name of 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole (CID 159325263) is 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole.
What is the SMILES notation for 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole?
The canonical SMILES for 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole is Brc1cscn1.Brc1ncsc1-c1scnc1Br.
What is the InChIKey of 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole?
The InChIKey is LEGWMPSPXDSQQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Br2N2S2.C3H2BrNS/c7-5-3(11-1-9-5)4-6(8)10-2-12-4;4-3-1-6-2-5-3/h1-2H;1-2H.
What are the key properties of 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole?
4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole has a molecular weight of 490.07 g/mol, XLogP of 5.70, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole;4-bromo-1,3-thiazole is sourced from PubChem (CID 159325263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).