C22H42O8Si — CID 15932572
methyl 6-[(2R,3R,4S,5S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydroxy-4-prop-2-enoxyoxan-2-yl]oxyhexanoate (PubChem CID 15932572) has the molecular formula C22H42O8Si and a molecular weight of 462.66 g/mol. Its IUPAC name is methyl 6-[(2R,3R,4S,5S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydroxy-4-prop-2-enoxyoxan-2-yl]oxyhexanoate.
| Compound Name | methyl 6-[(2R,3R,4S,5S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydroxy-4-prop-2-enoxyoxan-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 15932572 |
| Molecular Formula | C22H42O8Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | methyl 6-[(2R,3R,4S,5S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydroxy-4-prop-2-enoxyoxan-2-yl]oxyhexanoate |
| SMILES | C=CCO[C@H]1[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](OCCCCCC(=O)OC)[C@@H]1O |
| InChI | InChI=1S/C22H42O8Si/c1-8-13-27-20-18(24)16(15-29-31(6,7)22(2,3)4)30-21(19(20)25)28-14-11-9-10-12-17(23)26-5/h8,16,18-21,24-25H,1,9-15H2,2-7H3/t16-,18+,19-,20+,21-/m1/s1 |
| InChIKey | DRNPTQMMBHMMAS-KPACCLEDSA-N |
| XLogP | 2.78 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|