About 2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole
2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole (PubChem CID 159326036) has the molecular formula C42H28F6N2O2S2
and a molecular weight of 770.82 g/mol. Its IUPAC name is 2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole |
| PubChem CID | 159326036 |
| Molecular Formula | C42H28F6N2O2S2 |
| Molecular Weight | 770.82 g/mol |
| Exact Mass | 770.15 |
| IUPAC Name | 2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole |
| SMILES | FC(F)(F)c1ccc2sc(-c3ccc(OCc4ccccc4)cc3)nc2c1.FC(F)(F)c1ccc2sc(-c3ccc(OCc4ccccc4)cc3)nc2c1 |
| InChI | InChI=1S/2C21H14F3NOS/c2*22-21(23,24)16-8-11-19-18(12-16)25-20(27-19)15-6-9-17(10-7-15)26-13-14-4-2-1-3-5-14/h2*1-12H,13H2 |
| InChIKey | LEJLPVLTVGFLON-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 770.82 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole?
The IUPAC name of 2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole (CID 159326036) is 2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole.
What is the SMILES notation for 2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole?
The canonical SMILES for 2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole is FC(F)(F)c1ccc2sc(-c3ccc(OCc4ccccc4)cc3)nc2c1.FC(F)(F)c1ccc2sc(-c3ccc(OCc4ccccc4)cc3)nc2c1.
What is the InChIKey of 2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole?
The InChIKey is LEJLPVLTVGFLON-UHFFFAOYSA-N. The full InChI is InChI=1S/2C21H14F3NOS/c2*22-21(23,24)16-8-11-19-18(12-16)25-20(27-19)15-6-9-17(10-7-15)26-13-14-4-2-1-3-5-14/h2*1-12H,13H2.
What are the key properties of 2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole?
2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole has a molecular weight of 770.82 g/mol, XLogP of 13.12, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)-1,3-benzothiazole is sourced from PubChem (CID 159326036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).