About 3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine
3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine (PubChem CID 159326224) has the molecular formula C11H20ClN5S
and a molecular weight of 289.84 g/mol. Its IUPAC name is 3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine.
Molecular Properties
| Compound Name | 3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine |
| PubChem CID | 159326224 |
| Molecular Formula | C11H20ClN5S |
| Molecular Weight | 289.84 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine |
| SMILES | C1CNCCN1.Clc1nsnc1N1CCCCC1 |
| InChI | InChI=1S/C7H10ClN3S.C4H10N2/c8-6-7(10-12-9-6)11-4-2-1-3-5-11;1-2-6-4-3-5-1/h1-5H2;5-6H,1-4H2 |
| InChIKey | LEJYSAQIOLHSBJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.84 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine?
The IUPAC name of 3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine (CID 159326224) is 3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine.
What is the SMILES notation for 3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine?
The canonical SMILES for 3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine is C1CNCCN1.Clc1nsnc1N1CCCCC1.
What is the InChIKey of 3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine?
The InChIKey is LEJYSAQIOLHSBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3S.C4H10N2/c8-6-7(10-12-9-6)11-4-2-1-3-5-11;1-2-6-4-3-5-1/h1-5H2;5-6H,1-4H2.
What are the key properties of 3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine?
3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine has a molecular weight of 289.84 g/mol, XLogP of 1.36, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-piperidin-1-yl-1,2,5-thiadiazole;piperazine is sourced from PubChem (CID 159326224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).