About ruthenium;trimethylphosphane
ruthenium;trimethylphosphane (PubChem CID 159326675) has the molecular formula C3H9PRu2
and a molecular weight of 278.22 g/mol. Its IUPAC name is ruthenium;trimethylphosphane.
Molecular Properties
| Compound Name | ruthenium;trimethylphosphane |
| PubChem CID | 159326675 |
| Molecular Formula | C3H9PRu2 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 279.85 |
| IUPAC Name | ruthenium;trimethylphosphane |
| SMILES | CP(C)C.[Ru].[Ru] |
| InChI | InChI=1S/C3H9P.2Ru/c1-4(2)3;;/h1-3H3;; |
| InChIKey | LELIHYATYYMZBR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ruthenium;trimethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ruthenium;trimethylphosphane?
The IUPAC name of ruthenium;trimethylphosphane (CID 159326675) is ruthenium;trimethylphosphane.
What is the SMILES notation for ruthenium;trimethylphosphane?
The canonical SMILES for ruthenium;trimethylphosphane is CP(C)C.[Ru].[Ru].
What is the InChIKey of ruthenium;trimethylphosphane?
The InChIKey is LELIHYATYYMZBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9P.2Ru/c1-4(2)3;;/h1-3H3;;.
What are the key properties of ruthenium;trimethylphosphane?
ruthenium;trimethylphosphane has a molecular weight of 278.22 g/mol, XLogP of 1.35, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ruthenium;trimethylphosphane is sourced from PubChem (CID 159326675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).