C26H31BrO6 — CID 159326822
methyl 2-bromo-2-[2-(oxolan-2-yl)phenyl]acetate;methyl 2-[2-(oxolan-2-yl)phenyl]acetate (PubChem CID 159326822) has the molecular formula C26H31BrO6 and a molecular weight of 519.43 g/mol. Its IUPAC name is methyl 2-bromo-2-[2-(oxolan-2-yl)phenyl]acetate;methyl 2-[2-(oxolan-2-yl)phenyl]acetate.
| Compound Name | methyl 2-bromo-2-[2-(oxolan-2-yl)phenyl]acetate;methyl 2-[2-(oxolan-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 159326822 |
| Molecular Formula | C26H31BrO6 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | methyl 2-bromo-2-[2-(oxolan-2-yl)phenyl]acetate;methyl 2-[2-(oxolan-2-yl)phenyl]acetate |
| SMILES | COC(=O)C(Br)c1ccccc1C1CCCO1.COC(=O)Cc1ccccc1C1CCCO1 |
| InChI | InChI=1S/C13H15BrO3.C13H16O3/c1-16-13(15)12(14)10-6-3-2-5-9(10)11-7-4-8-17-11;1-15-13(14)9-10-5-2-3-6-11(10)12-7-4-8-16-12/h2-3,5-6,11-12H,4,7-8H2,1H3;2-3,5-6,12H,4,7-9H2,1H3 |
| InChIKey | LELUCBZVMFYMNT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|