C22H24Cl3F4N3O5 — CID 159327772
tert-butyl 2,6-difluoropyridine-3-carboxylate;tert-butyl 2,2,2-trichloroethanimidate;2,6-difluoropyridine-3-carboxylic acid (PubChem CID 159327772) has the molecular formula C22H24Cl3F4N3O5 and a molecular weight of 592.80 g/mol. Its IUPAC name is tert-butyl 2,6-difluoropyridine-3-carboxylate;tert-butyl 2,2,2-trichloroethanimidate;2,6-difluoropyridine-3-carboxylic acid.
| Compound Name | tert-butyl 2,6-difluoropyridine-3-carboxylate;tert-butyl 2,2,2-trichloroethanimidate;2,6-difluoropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 159327772 |
| Molecular Formula | C22H24Cl3F4N3O5 |
| Molecular Weight | 592.80 g/mol |
| Exact Mass | 591.07 |
| IUPAC Name | tert-butyl 2,6-difluoropyridine-3-carboxylate;tert-butyl 2,2,2-trichloroethanimidate;2,6-difluoropyridine-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)c1ccc(F)nc1F.O=C(O)c1ccc(F)nc1F.[H]/N=C(\OC(C)(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H11F2NO2.C6H10Cl3NO.C6H3F2NO2/c1-10(2,3)15-9(14)6-4-5-7(11)13-8(6)12;1-5(2,3)11-4(10)6(7,8)9;7-4-2-1-3(6(10)11)5(8)9-4/h4-5H,1-3H3;10H,1-3H3;1-2H,(H,10,11)/b;10-4-; |
| InChIKey | LEOUNRJCRYVVSI-UQEXBZBJSA-N |
| XLogP | 6.52 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.80 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|