About 1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate
1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate (PubChem CID 15932815) has the molecular formula C11H20O4S2
and a molecular weight of 280.41 g/mol. Its IUPAC name is 1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate.
Molecular Properties
| Compound Name | 1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate |
| PubChem CID | 15932815 |
| Molecular Formula | C11H20O4S2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate |
| SMILES | CC(=O)OCC1CSCCOCCOCCS1 |
| InChI | InChI=1S/C11H20O4S2/c1-10(12)15-8-11-9-16-6-4-13-2-3-14-5-7-17-11/h11H,2-9H2,1H3 |
| InChIKey | NAQPYUAQJBSCCA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate?
The IUPAC name of 1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate (CID 15932815) is 1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate.
What is the SMILES notation for 1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate?
The canonical SMILES for 1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate is CC(=O)OCC1CSCCOCCOCCS1.
What is the InChIKey of 1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate?
The InChIKey is NAQPYUAQJBSCCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4S2/c1-10(12)15-8-11-9-16-6-4-13-2-3-14-5-7-17-11/h11H,2-9H2,1H3.
What are the key properties of 1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate?
1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate has a molecular weight of 280.41 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxa-7,10-dithiacyclododec-8-ylmethyl acetate is sourced from PubChem (CID 15932815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).