C14H30O2Si3 — CID 15932823
methyl 1,2,3-tris(trimethylsilyl)cycloprop-2-ene-1-carboxylate (PubChem CID 15932823) has the molecular formula C14H30O2Si3 and a molecular weight of 314.65 g/mol. Its IUPAC name is methyl 1,2,3-tris(trimethylsilyl)cycloprop-2-ene-1-carboxylate.
| Compound Name | methyl 1,2,3-tris(trimethylsilyl)cycloprop-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 15932823 |
| Molecular Formula | C14H30O2Si3 |
| Molecular Weight | 314.65 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | methyl 1,2,3-tris(trimethylsilyl)cycloprop-2-ene-1-carboxylate |
| SMILES | COC(=O)C1([Si](C)(C)C)C([Si](C)(C)C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C14H30O2Si3/c1-16-13(15)14(19(8,9)10)11(17(2,3)4)12(14)18(5,6)7/h1-10H3 |
| InChIKey | WLAMFCDRLONEHR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|