C25H41N3O4 — CID 159328683
(4S,6aR)-2,2-dimethyl-3,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrole-4-carbaldehyde;bis((1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbaldehyde) (PubChem CID 159328683) has the molecular formula C25H41N3O4 and a molecular weight of 447.62 g/mol. Its IUPAC name is (4S,6aR)-2,2-dimethyl-3,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrole-4-carbaldehyde;bis((1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbaldehyde).
| Compound Name | (4S,6aR)-2,2-dimethyl-3,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrole-4-carbaldehyde;bis((1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbaldehyde) |
|---|---|
| PubChem CID | 159328683 |
| Molecular Formula | C25H41N3O4 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | (4S,6aR)-2,2-dimethyl-3,3a,4,5,6,6a-hexahydrofuro[2,3-c]pyrrole-4-carbaldehyde;bis((1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbaldehyde) |
| SMILES | CC1(C)CC2[C@H](CN[C@@H]2C=O)O1.CC1(C)[C@@H]2[C@@H](C=O)NC[C@@H]21.CC1(C)[C@@H]2[C@@H](C=O)NC[C@@H]21 |
| InChI | InChI=1S/C9H15NO2.2C8H13NO/c1-9(2)3-6-7(5-11)10-4-8(6)12-9;2*1-8(2)5-3-9-6(4-10)7(5)8/h5-8,10H,3-4H2,1-2H3;2*4-7,9H,3H2,1-2H3/t6?,7-,8+;2*5-,6+,7-/m100/s1 |
| InChIKey | LERVNPRCBAOFOR-UHOQUKMGSA-N |
| XLogP | 1.20 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|