C51H72N12O6S2 — CID 159328937
bis(4-[6-(butylamino)-3-(4-pyrrolidin-1-ylsulfonylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol);methane (PubChem CID 159328937) has the molecular formula C51H72N12O6S2 and a molecular weight of 1013.35 g/mol. Its IUPAC name is bis(4-[6-(butylamino)-3-(4-pyrrolidin-1-ylsulfonylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol);methane.
| Compound Name | bis(4-[6-(butylamino)-3-(4-pyrrolidin-1-ylsulfonylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol);methane |
|---|---|
| PubChem CID | 159328937 |
| Molecular Formula | C51H72N12O6S2 |
| Molecular Weight | 1013.35 g/mol |
| Exact Mass | 1012.51 |
| IUPAC Name | bis(4-[6-(butylamino)-3-(4-pyrrolidin-1-ylsulfonylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol);methane |
| SMILES | C.CCCCNc1ncc2c(-c3ccc(S(=O)(=O)N4CCCC4)cc3)nn(C3CCC(O)CC3)c2n1.CCCCNc1ncc2c(-c3ccc(S(=O)(=O)N4CCCC4)cc3)nn(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/2C25H34N6O3S.CH4/c2*1-2-3-14-26-25-27-17-22-23(29-31(24(22)28-25)19-8-10-20(32)11-9-19)18-6-12-21(13-7-18)35(33,34)30-15-4-5-16-30;/h2*6-7,12-13,17,19-20,32H,2-5,8-11,14-16H2,1H3,(H,26,27,28);1H4 |
| InChIKey | LESNEKAVIVLJJE-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 226.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.35 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|