About CID 159329141
CID 159329141 (PubChem CID 159329141) has the molecular formula CH5B2O2
and a molecular weight of 70.67 g/mol.
Molecular Properties
| Compound Name | CID 159329141 |
| PubChem CID | 159329141 |
| Molecular Formula | CH5B2O2 |
| Molecular Weight | 70.67 g/mol |
| Exact Mass | 71.05 |
| IUPAC Name | — |
| SMILES | CB(O)O.[B] |
| InChI | InChI=1S/CH5BO2.B/c1-2(3)4;/h3-4H,1H3; |
| InChIKey | YVSWPNBLVYKSNP-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 70.67 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159329141 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159329141?
The IUPAC name of CID 159329141 (CID 159329141) is not available.
What is the SMILES notation for CID 159329141?
The canonical SMILES for CID 159329141 is CB(O)O.[B].
What is the InChIKey of CID 159329141?
The InChIKey is YVSWPNBLVYKSNP-UHFFFAOYSA-N. The full InChI is InChI=1S/CH5BO2.B/c1-2(3)4;/h3-4H,1H3;.
What are the key properties of CID 159329141?
CID 159329141 has a molecular weight of 70.67 g/mol, XLogP of -1.29, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159329141 is sourced from PubChem (CID 159329141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).