C38H30Br2Cl2N6O6 — CID 159329779
2-[2-[4-(bromomethyl)phenyl]-2-oxoethyl]-5-[(5-chloro-2-pyridinyl)methoxy]pyridazin-3-one (PubChem CID 159329779) has the molecular formula C38H30Br2Cl2N6O6 and a molecular weight of 897.41 g/mol. Its IUPAC name is 2-[2-[4-(bromomethyl)phenyl]-2-oxoethyl]-5-[(5-chloro-2-pyridinyl)methoxy]pyridazin-3-one.
| Compound Name | 2-[2-[4-(bromomethyl)phenyl]-2-oxoethyl]-5-[(5-chloro-2-pyridinyl)methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 159329779 |
| Molecular Formula | C38H30Br2Cl2N6O6 |
| Molecular Weight | 897.41 g/mol |
| Exact Mass | 894.00 |
| IUPAC Name | 2-[2-[4-(bromomethyl)phenyl]-2-oxoethyl]-5-[(5-chloro-2-pyridinyl)methoxy]pyridazin-3-one |
| SMILES | O=C(Cn1ncc(OCc2ccc(Cl)cn2)cc1=O)c1ccc(CBr)cc1.O=C(Cn1ncc(OCc2ccc(Cl)cn2)cc1=O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/2C19H15BrClN3O3/c2*20-8-13-1-3-14(4-2-13)18(25)11-24-19(26)7-17(10-23-24)27-12-16-6-5-15(21)9-22-16/h2*1-7,9-10H,8,11-12H2 |
| InChIKey | LEVGLWQWPZYKHP-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 148.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.41 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|