About 4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile
4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile (PubChem CID 159331918) has the molecular formula C24H32N4O
and a molecular weight of 392.55 g/mol. Its IUPAC name is 4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile.
Molecular Properties
| Compound Name | 4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile |
| PubChem CID | 159331918 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile |
| SMILES | CCCC=O.CCCCNCc1ccc(C#N)cc1.N#Cc1ccc(CN)cc1 |
| InChI | InChI=1S/C12H16N2.C8H8N2.C4H8O/c1-2-3-8-14-10-12-6-4-11(9-13)5-7-12;9-5-7-1-2-8(6-10)4-3-7;1-2-3-4-5/h4-7,14H,2-3,8,10H2,1H3;1-4H,5,9H2;4H,2-3H2,1H3 |
| InChIKey | LFBHETCHBRJFKZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile?
The IUPAC name of 4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile (CID 159331918) is 4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile.
What is the SMILES notation for 4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile?
The canonical SMILES for 4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile is CCCC=O.CCCCNCc1ccc(C#N)cc1.N#Cc1ccc(CN)cc1.
What is the InChIKey of 4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile?
The InChIKey is LFBHETCHBRJFKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2.C8H8N2.C4H8O/c1-2-3-8-14-10-12-6-4-11(9-13)5-7-12;9-5-7-1-2-8(6-10)4-3-7;1-2-3-4-5/h4-7,14H,2-3,8,10H2,1H3;1-4H,5,9H2;4H,2-3H2,1H3.
What are the key properties of 4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile?
4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile has a molecular weight of 392.55 g/mol, XLogP of 4.45, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)benzonitrile;butanal;4-(butylaminomethyl)benzonitrile is sourced from PubChem (CID 159331918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).