About 6-iminocyclohexa-1,4-dien-1-ol
6-iminocyclohexa-1,4-dien-1-ol (PubChem CID 159333352) has the molecular formula C6H7NO
and a molecular weight of 109.13 g/mol. Its IUPAC name is 6-iminocyclohexa-1,4-dien-1-ol.
Molecular Properties
| Compound Name | 6-iminocyclohexa-1,4-dien-1-ol |
| PubChem CID | 159333352 |
| Molecular Formula | C6H7NO |
| Molecular Weight | 109.13 g/mol |
| Exact Mass | 109.05 |
| IUPAC Name | 6-iminocyclohexa-1,4-dien-1-ol |
| SMILES | [H]/N=C1\C=CCC=C1O |
| InChI | InChI=1S/C6H7NO/c7-5-3-1-2-4-6(5)8/h1,3-4,7-8H,2H2/b7-5+ |
| InChIKey | ZZJMEGIRGZSVEB-FNORWQNLSA-N |
| XLogP | 1.41 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.13 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-iminocyclohexa-1,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iminocyclohexa-1,4-dien-1-ol?
The IUPAC name of 6-iminocyclohexa-1,4-dien-1-ol (CID 159333352) is 6-iminocyclohexa-1,4-dien-1-ol.
What is the SMILES notation for 6-iminocyclohexa-1,4-dien-1-ol?
The canonical SMILES for 6-iminocyclohexa-1,4-dien-1-ol is [H]/N=C1\C=CCC=C1O.
What is the InChIKey of 6-iminocyclohexa-1,4-dien-1-ol?
The InChIKey is ZZJMEGIRGZSVEB-FNORWQNLSA-N. The full InChI is InChI=1S/C6H7NO/c7-5-3-1-2-4-6(5)8/h1,3-4,7-8H,2H2/b7-5+.
What are the key properties of 6-iminocyclohexa-1,4-dien-1-ol?
6-iminocyclohexa-1,4-dien-1-ol has a molecular weight of 109.13 g/mol, XLogP of 1.41, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iminocyclohexa-1,4-dien-1-ol is sourced from PubChem (CID 159333352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).