About methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane
methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane (PubChem CID 159333660) has the molecular formula C17H16N2O2S
and a molecular weight of 312.39 g/mol. Its IUPAC name is methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane.
Molecular Properties
| Compound Name | methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane |
| PubChem CID | 159333660 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane |
| SMILES | Cc1cc(-c2ccc(N=S(C)(=O)c3ccccc3)cc2)no1 |
| InChI | InChI=1S/C17H16N2O2S/c1-13-12-17(18-21-13)14-8-10-15(11-9-14)19-22(2,20)16-6-4-3-5-7-16/h3-12H,1-2H3 |
| InChIKey | LFGHXFMNTAWVAD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane?
The IUPAC name of methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane (CID 159333660) is methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane.
What is the SMILES notation for methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane?
The canonical SMILES for methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane is Cc1cc(-c2ccc(N=S(C)(=O)c3ccccc3)cc2)no1.
What is the InChIKey of methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane?
The InChIKey is LFGHXFMNTAWVAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2S/c1-13-12-17(18-21-13)14-8-10-15(11-9-14)19-22(2,20)16-6-4-3-5-7-16/h3-12H,1-2H3.
What are the key properties of methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane?
methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane has a molecular weight of 312.39 g/mol, XLogP of 4.44, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[4-(5-methyl-1,2-oxazol-3-yl)phenyl]imino-oxo-phenyl-λ6-sulfane is sourced from PubChem (CID 159333660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).