About 2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile
2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile (PubChem CID 15933387) has the molecular formula C16H14FN
and a molecular weight of 239.29 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile |
| PubChem CID | 15933387 |
| Molecular Formula | C16H14FN |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile |
| SMILES | Cc1ccc(C)c(Cc2ccc(F)cc2)c1C#N |
| InChI | InChI=1S/C16H14FN/c1-11-3-4-12(2)16(10-18)15(11)9-13-5-7-14(17)8-6-13/h3-8H,9H2,1-2H3 |
| InChIKey | IXCLLVPVRBHKDA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile?
The IUPAC name of 2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile (CID 15933387) is 2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile.
What is the SMILES notation for 2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile?
The canonical SMILES for 2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile is Cc1ccc(C)c(Cc2ccc(F)cc2)c1C#N.
What is the InChIKey of 2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile?
The InChIKey is IXCLLVPVRBHKDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FN/c1-11-3-4-12(2)16(10-18)15(11)9-13-5-7-14(17)8-6-13/h3-8H,9H2,1-2H3.
What are the key properties of 2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile?
2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile has a molecular weight of 239.29 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluorophenyl)methyl]-3,6-dimethylbenzonitrile is sourced from PubChem (CID 15933387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).