C36H40F6N4O7 — CID 159334067
6-(diethoxymethyl)pyridine-2-carboxylic acid;6-(diethoxymethyl)-N-[3-(trifluoromethyl)phenyl]pyridine-2-carboxamide;3-(trifluoromethyl)aniline (PubChem CID 159334067) has the molecular formula C36H40F6N4O7 and a molecular weight of 754.72 g/mol. Its IUPAC name is 6-(diethoxymethyl)pyridine-2-carboxylic acid;6-(diethoxymethyl)-N-[3-(trifluoromethyl)phenyl]pyridine-2-carboxamide;3-(trifluoromethyl)aniline.
| Compound Name | 6-(diethoxymethyl)pyridine-2-carboxylic acid;6-(diethoxymethyl)-N-[3-(trifluoromethyl)phenyl]pyridine-2-carboxamide;3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 159334067 |
| Molecular Formula | C36H40F6N4O7 |
| Molecular Weight | 754.72 g/mol |
| Exact Mass | 754.28 |
| IUPAC Name | 6-(diethoxymethyl)pyridine-2-carboxylic acid;6-(diethoxymethyl)-N-[3-(trifluoromethyl)phenyl]pyridine-2-carboxamide;3-(trifluoromethyl)aniline |
| SMILES | CCOC(OCC)c1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)n1.CCOC(OCC)c1cccc(C(=O)O)n1.Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F3N2O3.C11H15NO4.C7H6F3N/c1-3-25-17(26-4-2)15-10-6-9-14(23-15)16(24)22-13-8-5-7-12(11-13)18(19,20)21;1-3-15-11(16-4-2)9-7-5-6-8(12-9)10(13)14;8-7(9,10)5-2-1-3-6(11)4-5/h5-11,17H,3-4H2,1-2H3,(H,22,24);5-7,11H,3-4H2,1-2H3,(H,13,14);1-4H,11H2 |
| InChIKey | LFHPBJRBOWAEJP-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 155.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.72 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|