C13H14O4S2 — CID 159334621
2,3-dihydrothieno[3,4-b][1,4]dioxine;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 159334621) has the molecular formula C13H14O4S2 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,4-b][1,4]dioxine;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 2,3-dihydrothieno[3,4-b][1,4]dioxine;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 159334621 |
| Molecular Formula | C13H14O4S2 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2,3-dihydrothieno[3,4-b][1,4]dioxine;5-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | Cc1scc2c1OCCO2.c1scc2c1OCCO2 |
| InChI | InChI=1S/C7H8O2S.C6H6O2S/c1-5-7-6(4-10-5)8-2-3-9-7;1-2-8-6-4-9-3-5(6)7-1/h4H,2-3H2,1H3;3-4H,1-2H2 |
| InChIKey | LFJIFXXLTOUGAR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |