C31H44N4O6 — CID 159336340
benzyl N-[(3R)-piperidin-3-yl]carbamate;tert-butyl (3R)-3-(phenylmethoxycarbonylamino)piperidine-1-carboxylate (PubChem CID 159336340) has the molecular formula C31H44N4O6 and a molecular weight of 568.72 g/mol. Its IUPAC name is benzyl N-[(3R)-piperidin-3-yl]carbamate;tert-butyl (3R)-3-(phenylmethoxycarbonylamino)piperidine-1-carboxylate.
| Compound Name | benzyl N-[(3R)-piperidin-3-yl]carbamate;tert-butyl (3R)-3-(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 159336340 |
| Molecular Formula | C31H44N4O6 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | benzyl N-[(3R)-piperidin-3-yl]carbamate;tert-butyl (3R)-3-(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](NC(=O)OCc2ccccc2)C1.O=C(N[C@@H]1CCCNC1)OCc1ccccc1 |
| InChI | InChI=1S/C18H26N2O4.C13H18N2O2/c1-18(2,3)24-17(22)20-11-7-10-15(12-20)19-16(21)23-13-14-8-5-4-6-9-14;16-13(15-12-7-4-8-14-9-12)17-10-11-5-2-1-3-6-11/h4-6,8-9,15H,7,10-13H2,1-3H3,(H,19,21);1-3,5-6,12,14H,4,7-10H2,(H,15,16)/t15-;12-/m11/s1 |
| InChIKey | LFOXFYVDMYZAOT-BFHPKYLASA-N |
| XLogP | 4.98 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|