C12H19NOSi — CID 15933773
(1E)-1-(trimethylsilylmethylidene)-2,3,6,8a-tetrahydroindolizin-5-one (PubChem CID 15933773) has the molecular formula C12H19NOSi and a molecular weight of 221.38 g/mol. Its IUPAC name is (1E)-1-(trimethylsilylmethylidene)-2,3,6,8a-tetrahydroindolizin-5-one.
| Compound Name | (1E)-1-(trimethylsilylmethylidene)-2,3,6,8a-tetrahydroindolizin-5-one |
|---|---|
| PubChem CID | 15933773 |
| Molecular Formula | C12H19NOSi |
| Molecular Weight | 221.38 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (1E)-1-(trimethylsilylmethylidene)-2,3,6,8a-tetrahydroindolizin-5-one |
| SMILES | C[Si](C)(C)/C=C1\CCN2C(=O)CC=CC12 |
| InChI | InChI=1S/C12H19NOSi/c1-15(2,3)9-10-7-8-13-11(10)5-4-6-12(13)14/h4-5,9,11H,6-8H2,1-3H3/b10-9+ |
| InChIKey | PLPARPVYOLBRCU-MDZDMXLPSA-N |
| XLogP | 2.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|