About 1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol
1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol (PubChem CID 159337993) has the molecular formula C7H14Cl2OS2
and a molecular weight of 249.23 g/mol. Its IUPAC name is 1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol.
Molecular Properties
| Compound Name | 1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol |
| PubChem CID | 159337993 |
| Molecular Formula | C7H14Cl2OS2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol |
| SMILES | CC(CS)CS.O=C(CCl)CCl |
| InChI | InChI=1S/C4H10S2.C3H4Cl2O/c1-4(2-5)3-6;4-1-3(6)2-5/h4-6H,2-3H2,1H3;1-2H2 |
| InChIKey | LFUCHVAGRNVTDU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol?
The IUPAC name of 1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol (CID 159337993) is 1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol.
What is the SMILES notation for 1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol?
The canonical SMILES for 1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol is CC(CS)CS.O=C(CCl)CCl.
What is the InChIKey of 1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol?
The InChIKey is LFUCHVAGRNVTDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10S2.C3H4Cl2O/c1-4(2-5)3-6;4-1-3(6)2-5/h4-6H,2-3H2,1H3;1-2H2.
What are the key properties of 1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol?
1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol has a molecular weight of 249.23 g/mol, XLogP of 2.52, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloropropan-2-one;2-methylpropane-1,3-dithiol is sourced from PubChem (CID 159337993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).