About (5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane
(5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane (PubChem CID 159339071) has the molecular formula C10H13FN2OSn
and a molecular weight of 314.94 g/mol. Its IUPAC name is (5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane.
Molecular Properties
| Compound Name | (5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane |
| PubChem CID | 159339071 |
| Molecular Formula | C10H13FN2OSn |
| Molecular Weight | 314.94 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | (5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane |
| SMILES | Cc1cc(F)c([Sn](C)(C)C)c2nonc12 |
| InChI | InChI=1S/C7H4FN2O.3CH3.Sn/c1-4-2-5(8)3-6-7(4)10-11-9-6;;;;/h2H,1H3;3*1H3; |
| InChIKey | SPJFTQVXPZRGLN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.94 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane?
The IUPAC name of (5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane (CID 159339071) is (5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane.
What is the SMILES notation for (5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane?
The canonical SMILES for (5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane is Cc1cc(F)c([Sn](C)(C)C)c2nonc12.
What is the InChIKey of (5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane?
The InChIKey is SPJFTQVXPZRGLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FN2O.3CH3.Sn/c1-4-2-5(8)3-6-7(4)10-11-9-6;;;;/h2H,1H3;3*1H3;.
What are the key properties of (5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane?
(5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane has a molecular weight of 314.94 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-7-methyl-2,1,3-benzoxadiazol-4-yl)-trimethylstannane is sourced from PubChem (CID 159339071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).