C30H39N7O5 — CID 159341385
N-[5-cyano-4-(3-methoxypropyl)-2-pyridinyl]-7-(dimethoxymethyl)-6-[(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 159341385) has the molecular formula C30H39N7O5 and a molecular weight of 577.69 g/mol. Its IUPAC name is N-[5-cyano-4-(3-methoxypropyl)-2-pyridinyl]-7-(dimethoxymethyl)-6-[(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[5-cyano-4-(3-methoxypropyl)-2-pyridinyl]-7-(dimethoxymethyl)-6-[(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 159341385 |
| Molecular Formula | C30H39N7O5 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | N-[5-cyano-4-(3-methoxypropyl)-2-pyridinyl]-7-(dimethoxymethyl)-6-[(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COCCCc1cc(NC(=O)N2CCCc3cc(CN4CCN5CCCC5C4=O)c(C(OC)OC)nc32)ncc1C#N |
| InChI | InChI=1S/C30H39N7O5/c1-40-14-6-8-20-16-25(32-18-23(20)17-31)33-30(39)37-11-4-7-21-15-22(26(34-27(21)37)29(41-2)42-3)19-36-13-12-35-10-5-9-24(35)28(36)38/h15-16,18,24,29H,4-14,19H2,1-3H3,(H,32,33,39) |
| InChIKey | NWBKOIZWUIXFOB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|