C9H13F3N2O3 — CID 159341771
4,7-diazaspiro[2.5]octane-7-carbaldehyde;2,2,2-trifluoroacetic acid (PubChem CID 159341771) has the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. Its IUPAC name is 4,7-diazaspiro[2.5]octane-7-carbaldehyde;2,2,2-trifluoroacetic acid.
| Compound Name | 4,7-diazaspiro[2.5]octane-7-carbaldehyde;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159341771 |
| Molecular Formula | C9H13F3N2O3 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 4,7-diazaspiro[2.5]octane-7-carbaldehyde;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=CN1CCNC2(CC2)C1 |
| InChI | InChI=1S/C7H12N2O.C2HF3O2/c10-6-9-4-3-8-7(5-9)1-2-7;3-2(4,5)1(6)7/h6,8H,1-5H2;(H,6,7) |
| InChIKey | OHDURLQNMAUUDC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|