About 2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid)
2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 159342983) has the molecular formula C12H10F6N4O4
and a molecular weight of 388.22 g/mol. Its IUPAC name is 2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid).
Molecular Properties
| Compound Name | 2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid) |
| PubChem CID | 159342983 |
| Molecular Formula | C12H10F6N4O4 |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Nc1ccnc(-n2cccn2)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H8N4.2C2HF3O2/c9-7-2-4-10-8(6-7)12-5-1-3-11-12;2*3-2(4,5)1(6)7/h1-6H,(H2,9,10);2*(H,6,7) |
| InChIKey | LGJDFPKUEHDAAQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid)?
The IUPAC name of 2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid) (CID 159342983) is 2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid).
What is the SMILES notation for 2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid)?
The canonical SMILES for 2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid) is Nc1ccnc(-n2cccn2)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.
What is the InChIKey of 2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid)?
The InChIKey is LGJDFPKUEHDAAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4.2C2HF3O2/c9-7-2-4-10-8(6-7)12-5-1-3-11-12;2*3-2(4,5)1(6)7/h1-6H,(H2,9,10);2*(H,6,7).
What are the key properties of 2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid)?
2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid) has a molecular weight of 388.22 g/mol, XLogP of 2.12, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazol-1-ylpyridin-4-amine;bis(2,2,2-trifluoroacetic acid) is sourced from PubChem (CID 159342983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).