C15H20F3NO3 — CID 159343397
(1R)-cyclohex-3-ene-1-carboxylic acid;N-[(1R)-cyclohex-3-en-1-yl]-2,2,2-trifluoroacetamide (PubChem CID 159343397) has the molecular formula C15H20F3NO3 and a molecular weight of 319.32 g/mol. Its IUPAC name is (1R)-cyclohex-3-ene-1-carboxylic acid;N-[(1R)-cyclohex-3-en-1-yl]-2,2,2-trifluoroacetamide.
| Compound Name | (1R)-cyclohex-3-ene-1-carboxylic acid;N-[(1R)-cyclohex-3-en-1-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 159343397 |
| Molecular Formula | C15H20F3NO3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (1R)-cyclohex-3-ene-1-carboxylic acid;N-[(1R)-cyclohex-3-en-1-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(N[C@H]1CC=CCC1)C(F)(F)F.O=C(O)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C8H10F3NO.C7H10O2/c9-8(10,11)7(13)12-6-4-2-1-3-5-6;8-7(9)6-4-2-1-3-5-6/h1-2,6H,3-5H2,(H,12,13);1-2,6H,3-5H2,(H,8,9)/t2*6-/m00/s1 |
| InChIKey | LGKKZTKNTBFTKN-HKGPVOKGSA-N |
| XLogP | 3.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|