C20H24O3 — CID 15934393
6-(1-phenylethenyl)spiro[1,2,4-trioxane-3,2'-adamantane] (PubChem CID 15934393) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 6-(1-phenylethenyl)spiro[1,2,4-trioxane-3,2'-adamantane].
| Compound Name | 6-(1-phenylethenyl)spiro[1,2,4-trioxane-3,2'-adamantane] |
|---|---|
| PubChem CID | 15934393 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 6-(1-phenylethenyl)spiro[1,2,4-trioxane-3,2'-adamantane] |
| SMILES | C=C(c1ccccc1)C1COC2(OO1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C20H24O3/c1-13(16-5-3-2-4-6-16)19-12-21-20(23-22-19)17-8-14-7-15(10-17)11-18(20)9-14/h2-6,14-15,17-19H,1,7-12H2 |
| InChIKey | YZVZZEPEBQFDHM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|