C52H72 — CID 159344216
1-[1,1-bis(2,3,4,5,6-pentamethylphenyl)prop-1-en-2-yl]-2,3,4,5,6-pentamethylbenzene;1,2,3,4,5-pentamethyl-6-(3-methylbut-2-en-2-yl)benzene (PubChem CID 159344216) has the molecular formula C52H72 and a molecular weight of 697.15 g/mol. Its IUPAC name is 1-[1,1-bis(2,3,4,5,6-pentamethylphenyl)prop-1-en-2-yl]-2,3,4,5,6-pentamethylbenzene;1,2,3,4,5-pentamethyl-6-(3-methylbut-2-en-2-yl)benzene.
| Compound Name | 1-[1,1-bis(2,3,4,5,6-pentamethylphenyl)prop-1-en-2-yl]-2,3,4,5,6-pentamethylbenzene;1,2,3,4,5-pentamethyl-6-(3-methylbut-2-en-2-yl)benzene |
|---|---|
| PubChem CID | 159344216 |
| Molecular Formula | C52H72 |
| Molecular Weight | 697.15 g/mol |
| Exact Mass | 696.56 |
| IUPAC Name | 1-[1,1-bis(2,3,4,5,6-pentamethylphenyl)prop-1-en-2-yl]-2,3,4,5,6-pentamethylbenzene;1,2,3,4,5-pentamethyl-6-(3-methylbut-2-en-2-yl)benzene |
| SMILES | CC(=C(c1c(C)c(C)c(C)c(C)c1C)c1c(C)c(C)c(C)c(C)c1C)c1c(C)c(C)c(C)c(C)c1C.CC(C)=C(C)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C36H48.C16H24/c1-17-20(4)26(10)33(27(11)21(17)5)32(16)36(34-28(12)22(6)18(2)23(7)29(34)13)35-30(14)24(8)19(3)25(9)31(35)15;1-9(2)10(3)16-14(7)12(5)11(4)13(6)15(16)8/h1-16H3;1-8H3 |
| InChIKey | LGMZOCJYWPDFMY-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.15 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|