C32H27ClN6O10 — CID 159344383
2-chloro-5-nitropyridine;6,7-dimethoxy-4-[(5-nitro-2-pyridinyl)oxy]quinoline;6,7-dimethoxy-1H-quinolin-4-one (PubChem CID 159344383) has the molecular formula C32H27ClN6O10 and a molecular weight of 691.05 g/mol. Its IUPAC name is 2-chloro-5-nitropyridine;6,7-dimethoxy-4-[(5-nitro-2-pyridinyl)oxy]quinoline;6,7-dimethoxy-1H-quinolin-4-one.
| Compound Name | 2-chloro-5-nitropyridine;6,7-dimethoxy-4-[(5-nitro-2-pyridinyl)oxy]quinoline;6,7-dimethoxy-1H-quinolin-4-one |
|---|---|
| PubChem CID | 159344383 |
| Molecular Formula | C32H27ClN6O10 |
| Molecular Weight | 691.05 g/mol |
| Exact Mass | 690.15 |
| IUPAC Name | 2-chloro-5-nitropyridine;6,7-dimethoxy-4-[(5-nitro-2-pyridinyl)oxy]quinoline;6,7-dimethoxy-1H-quinolin-4-one |
| SMILES | COc1cc2[nH]ccc(=O)c2cc1OC.COc1cc2nccc(Oc3ccc([N+](=O)[O-])cn3)c2cc1OC.O=[N+]([O-])c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H13N3O5.C11H11NO3.C5H3ClN2O2/c1-22-14-7-11-12(8-15(14)23-2)17-6-5-13(11)24-16-4-3-10(9-18-16)19(20)21;1-14-10-5-7-8(6-11(10)15-2)12-4-3-9(7)13;6-5-2-1-4(3-7-5)8(9)10/h3-9H,1-2H3;3-6H,1-2H3,(H,12,13);1-3H |
| InChIKey | LGNNKIGTJXCIQJ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 203.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.05 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|