C21H18F3N5O2S — CID 159344575
4-[(2-oxo-3H-1-benzothiophen-6-yl)amino]-N-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 159344575) has the molecular formula C21H18F3N5O2S and a molecular weight of 461.47 g/mol. Its IUPAC name is 4-[(2-oxo-3H-1-benzothiophen-6-yl)amino]-N-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | 4-[(2-oxo-3H-1-benzothiophen-6-yl)amino]-N-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 159344575 |
| Molecular Formula | C21H18F3N5O2S |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 4-[(2-oxo-3H-1-benzothiophen-6-yl)amino]-N-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | O=C1Cc2ccc(Nc3ncnc4[nH]c5c(c34)CC(C(=O)NCC(F)(F)F)CC5)cc2S1 |
| InChI | InChI=1S/C21H18F3N5O2S/c22-21(23,24)8-25-20(31)11-2-4-14-13(5-11)17-18(26-9-27-19(17)29-14)28-12-3-1-10-6-16(30)32-15(10)7-12/h1,3,7,9,11H,2,4-6,8H2,(H,25,31)(H2,26,27,28,29) |
| InChIKey | QOQUVVDPPYTXDE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|