C16H12N4O2 — CID 159345140
1,4-bis(4-diazocyclohexa-1,5-dien-1-yl)but-2-ene-1,4-dione (PubChem CID 159345140) has the molecular formula C16H12N4O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 1,4-bis(4-diazocyclohexa-1,5-dien-1-yl)but-2-ene-1,4-dione.
| Compound Name | 1,4-bis(4-diazocyclohexa-1,5-dien-1-yl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 159345140 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1,4-bis(4-diazocyclohexa-1,5-dien-1-yl)but-2-ene-1,4-dione |
| SMILES | [N-]=[N+]=C1C=CC(C(=O)C=CC(=O)C2=CCC(=[N+]=[N-])C=C2)=CC1 |
| InChI | InChI=1S/C16H12N4O2/c17-19-13-5-1-11(2-6-13)15(21)9-10-16(22)12-3-7-14(20-18)8-4-12/h1-5,7,9-10H,6,8H2 |
| InChIKey | LGPYDWZAZJHHBR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 106.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|