C38H42BBrCl2O6 — CID 159345586
1-bromo-4-chloro-2-methylbenzene;ethyl 2-(4-chloro-2-methylphenyl)benzoate;ethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 159345586) has the molecular formula C38H42BBrCl2O6 and a molecular weight of 756.37 g/mol. Its IUPAC name is 1-bromo-4-chloro-2-methylbenzene;ethyl 2-(4-chloro-2-methylphenyl)benzoate;ethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | 1-bromo-4-chloro-2-methylbenzene;ethyl 2-(4-chloro-2-methylphenyl)benzoate;ethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 159345586 |
| Molecular Formula | C38H42BBrCl2O6 |
| Molecular Weight | 756.37 g/mol |
| Exact Mass | 754.16 |
| IUPAC Name | 1-bromo-4-chloro-2-methylbenzene;ethyl 2-(4-chloro-2-methylphenyl)benzoate;ethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | CCOC(=O)c1ccccc1-c1ccc(Cl)cc1C.CCOC(=O)c1ccccc1B1OC(C)(C)C(C)(C)O1.Cc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C16H15ClO2.C15H21BO4.C7H6BrCl/c1-3-19-16(18)15-7-5-4-6-14(15)13-9-8-12(17)10-11(13)2;1-6-18-13(17)11-9-7-8-10-12(11)16-19-14(2,3)15(4,5)20-16;1-5-4-6(9)2-3-7(5)8/h4-10H,3H2,1-2H3;7-10H,6H2,1-5H3;2-4H,1H3 |
| InChIKey | LGRKQJCKLAAYOL-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.37 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|