C29H32N3+ — CID 159345703
9-[4-(cyclohexylmethyl)-1,5-dimethylpyridin-1-ium-2-yl]-8-methyl-11H-indolo[1,2-a]benzimidazole (PubChem CID 159345703) has the molecular formula C29H32N3+ and a molecular weight of 422.60 g/mol. Its IUPAC name is 9-[4-(cyclohexylmethyl)-1,5-dimethylpyridin-1-ium-2-yl]-8-methyl-11H-indolo[1,2-a]benzimidazole.
| Compound Name | 9-[4-(cyclohexylmethyl)-1,5-dimethylpyridin-1-ium-2-yl]-8-methyl-11H-indolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 159345703 |
| Molecular Formula | C29H32N3+ |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 9-[4-(cyclohexylmethyl)-1,5-dimethylpyridin-1-ium-2-yl]-8-methyl-11H-indolo[1,2-a]benzimidazole |
| SMILES | Cc1c[n+](C)c(-c2c(C)ccc3c2nc2n3-c3ccccc3C2)cc1CC1CCCCC1 |
| InChI | InChI=1S/C29H32N3/c1-19-13-14-25-29(30-27-17-22-11-7-8-12-24(22)32(25)27)28(19)26-16-23(20(2)18-31(26)3)15-21-9-5-4-6-10-21/h7-8,11-14,16,18,21H,4-6,9-10,15,17H2,1-3H3/q+1 |
| InChIKey | AAAUZWDMFDJBJF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|