C32H54O3SSi — CID 159345712
(9S,10R,13S,14R,17R)-17-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(3-hydroxy-3-methylbutyl)sulfanylethyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one (PubChem CID 159345712) has the molecular formula C32H54O3SSi and a molecular weight of 546.93 g/mol. Its IUPAC name is (9S,10R,13S,14R,17R)-17-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(3-hydroxy-3-methylbutyl)sulfanylethyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | (9S,10R,13S,14R,17R)-17-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(3-hydroxy-3-methylbutyl)sulfanylethyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 159345712 |
| Molecular Formula | C32H54O3SSi |
| Molecular Weight | 546.93 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | (9S,10R,13S,14R,17R)-17-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(3-hydroxy-3-methylbutyl)sulfanylethyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one |
| SMILES | CC(C)(O)CCS[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1C(=O)C[C@H]2C3=CC=C4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H54O3SSi/c1-29(2,3)37(8,9)35-21-27(36-19-18-30(4,5)34)28-26(33)20-25-23-14-13-22-12-10-11-16-31(22,6)24(23)15-17-32(25,28)7/h13-14,24-25,27-28,34H,10-12,15-21H2,1-9H3/t24-,25-,27+,28+,31-,32-/m0/s1 |
| InChIKey | LGRUMJPCMBUITK-RLPSTQDUSA-N |
| XLogP | 8.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.93 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|