About azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide
azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide (PubChem CID 159346014) has the molecular formula C9H20N4O5S2
and a molecular weight of 328.42 g/mol. Its IUPAC name is azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide.
Molecular Properties
| Compound Name | azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide |
| PubChem CID | 159346014 |
| Molecular Formula | C9H20N4O5S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CN(C2COC2)C1.NS(=O)(=O)C1CNC1 |
| InChI | InChI=1S/C6H12N2O3S.C3H8N2O2S/c7-12(9,10)6-1-8(2-6)5-3-11-4-5;4-8(6,7)3-1-5-2-3/h5-6H,1-4H2,(H2,7,9,10);3,5H,1-2H2,(H2,4,6,7) |
| InChIKey | LGSUAGGCFSGNSK-UHFFFAOYSA-N |
| XLogP | -3.40 |
| TPSA | 144.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide?
The IUPAC name of azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide (CID 159346014) is azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide.
What is the SMILES notation for azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide?
The canonical SMILES for azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide is NS(=O)(=O)C1CN(C2COC2)C1.NS(=O)(=O)C1CNC1.
What is the InChIKey of azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide?
The InChIKey is LGSUAGGCFSGNSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O3S.C3H8N2O2S/c7-12(9,10)6-1-8(2-6)5-3-11-4-5;4-8(6,7)3-1-5-2-3/h5-6H,1-4H2,(H2,7,9,10);3,5H,1-2H2,(H2,4,6,7).
What are the key properties of azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide?
azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide has a molecular weight of 328.42 g/mol, XLogP of -3.40, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azetidine-3-sulfonamide;1-(oxetan-3-yl)azetidine-3-sulfonamide is sourced from PubChem (CID 159346014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).