C22H32B2Cl2N2O5 — CID 159346113
2-aminobutan-1-ol;1-[(5-chloro-3H-2,1-benzoxaborol-1-yl)oxy]butan-2-amine;5-chloro-1-hydroxy-3H-2,1-benzoxaborole (PubChem CID 159346113) has the molecular formula C22H32B2Cl2N2O5 and a molecular weight of 497.04 g/mol. Its IUPAC name is 2-aminobutan-1-ol;1-[(5-chloro-3H-2,1-benzoxaborol-1-yl)oxy]butan-2-amine;5-chloro-1-hydroxy-3H-2,1-benzoxaborole.
| Compound Name | 2-aminobutan-1-ol;1-[(5-chloro-3H-2,1-benzoxaborol-1-yl)oxy]butan-2-amine;5-chloro-1-hydroxy-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 159346113 |
| Molecular Formula | C22H32B2Cl2N2O5 |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 2-aminobutan-1-ol;1-[(5-chloro-3H-2,1-benzoxaborol-1-yl)oxy]butan-2-amine;5-chloro-1-hydroxy-3H-2,1-benzoxaborole |
| SMILES | CCC(N)CO.CCC(N)COB1OCc2cc(Cl)ccc21.OB1OCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H15BClNO2.C7H6BClO2.C4H11NO/c1-2-10(14)7-16-12-11-4-3-9(13)5-8(11)6-15-12;9-6-1-2-7-5(3-6)4-11-8(7)10;1-2-4(5)3-6/h3-5,10H,2,6-7,14H2,1H3;1-3,10H,4H2;4,6H,2-3,5H2,1H3 |
| InChIKey | LGTBUATYBAYLHN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|