C32H43NO8S — CID 159346254
6-[4-[4-[[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]amino]-2,4-dioxobutyl]sulfanylphenyl]-5-oxohexanoic acid (PubChem CID 159346254) has the molecular formula C32H43NO8S and a molecular weight of 601.76 g/mol. Its IUPAC name is 6-[4-[4-[[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]amino]-2,4-dioxobutyl]sulfanylphenyl]-5-oxohexanoic acid.
| Compound Name | 6-[4-[4-[[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]amino]-2,4-dioxobutyl]sulfanylphenyl]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 159346254 |
| Molecular Formula | C32H43NO8S |
| Molecular Weight | 601.76 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | 6-[4-[4-[[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]amino]-2,4-dioxobutyl]sulfanylphenyl]-5-oxohexanoic acid |
| SMILES | CO[C@@H]1[C@H](NC(=O)CC(=O)CSc2ccc(CC(=O)CCCC(=O)O)cc2)CC[C@]2(CO2)[C@H]1[C@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C32H43NO8S/c1-20(2)8-13-26-31(3,41-26)30-29(39-4)25(14-15-32(30)19-40-32)33-27(36)17-23(35)18-42-24-11-9-21(10-12-24)16-22(34)6-5-7-28(37)38/h8-12,25-26,29-30H,5-7,13-19H2,1-4H3,(H,33,36)(H,37,38)/t25-,26-,29-,30-,31-,32+/m1/s1 |
| InChIKey | ZKJRZOPSXWSBLT-QQZPFGQYSA-N |
| XLogP | 4.30 |
| TPSA | 134.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.76 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|