C20H21NO4 — CID 159346276
2-[4-(2,3-dioxobutyl)phenyl]-N-(2-hydroxyethyl)-N-phenylacetamide (PubChem CID 159346276) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-[4-(2,3-dioxobutyl)phenyl]-N-(2-hydroxyethyl)-N-phenylacetamide.
| Compound Name | 2-[4-(2,3-dioxobutyl)phenyl]-N-(2-hydroxyethyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 159346276 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[4-(2,3-dioxobutyl)phenyl]-N-(2-hydroxyethyl)-N-phenylacetamide |
| SMILES | CC(=O)C(=O)Cc1ccc(CC(=O)N(CCO)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-15(23)19(24)13-16-7-9-17(10-8-16)14-20(25)21(11-12-22)18-5-3-2-4-6-18/h2-10,22H,11-14H2,1H3 |
| InChIKey | MGLAXUWSNIJFOT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|