C12H22N6O4S — CID 159346773
benzene-1,2-diamine;1-propan-2-ylpyrazole-4,5-diamine;sulfuric acid (PubChem CID 159346773) has the molecular formula C12H22N6O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is benzene-1,2-diamine;1-propan-2-ylpyrazole-4,5-diamine;sulfuric acid.
| Compound Name | benzene-1,2-diamine;1-propan-2-ylpyrazole-4,5-diamine;sulfuric acid |
|---|---|
| PubChem CID | 159346773 |
| Molecular Formula | C12H22N6O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | benzene-1,2-diamine;1-propan-2-ylpyrazole-4,5-diamine;sulfuric acid |
| SMILES | CC(C)n1ncc(N)c1N.Nc1ccccc1N.O=S(=O)(O)O |
| InChI | InChI=1S/C6H12N4.C6H8N2.H2O4S/c1-4(2)10-6(8)5(7)3-9-10;7-5-3-1-2-4-6(5)8;1-5(2,3)4/h3-4H,7-8H2,1-2H3;1-4H,7-8H2;(H2,1,2,3,4) |
| InChIKey | LGVAKCGZSYRBQF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 196.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|