C38H34 — CID 159346959
1,1'-biphenyl;1-methyl-2-phenylbenzene;1-methyl-3-phenylbenzene (PubChem CID 159346959) has the molecular formula C38H34 and a molecular weight of 490.69 g/mol. Its IUPAC name is 1,1'-biphenyl;1-methyl-2-phenylbenzene;1-methyl-3-phenylbenzene.
| Compound Name | 1,1'-biphenyl;1-methyl-2-phenylbenzene;1-methyl-3-phenylbenzene |
|---|---|
| PubChem CID | 159346959 |
| Molecular Formula | C38H34 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 1,1'-biphenyl;1-methyl-2-phenylbenzene;1-methyl-3-phenylbenzene |
| SMILES | Cc1cccc(-c2ccccc2)c1.Cc1ccccc1-c1ccccc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/2C13H12.C12H10/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12;1-11-6-5-9-13(10-11)12-7-3-2-4-8-12;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h2*2-10H,1H3;1-10H |
| InChIKey | LGVNTTRPNFZBAF-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |