About 2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid
2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid (PubChem CID 15934705) has the molecular formula C16H20N2O6S
and a molecular weight of 368.41 g/mol. Its IUPAC name is 2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid |
| PubChem CID | 15934705 |
| Molecular Formula | C16H20N2O6S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid |
| SMILES | CC[C@H]1C(=O)N(S(=O)(=O)c2ccc(C)cc2)[C@H]1C(=O)N(C)CC(=O)O |
| InChI | InChI=1S/C16H20N2O6S/c1-4-12-14(16(22)17(3)9-13(19)20)18(15(12)21)25(23,24)11-7-5-10(2)6-8-11/h5-8,12,14H,4,9H2,1-3H3,(H,19,20)/t12-,14-/m1/s1 |
| InChIKey | DKQIVUKDLNNDLA-TZMCWYRMSA-N |
| XLogP | 0.46 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid?
The IUPAC name of 2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid (CID 15934705) is 2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid.
What is the SMILES notation for 2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid?
The canonical SMILES for 2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid is CC[C@H]1C(=O)N(S(=O)(=O)c2ccc(C)cc2)[C@H]1C(=O)N(C)CC(=O)O.
What is the InChIKey of 2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid?
The InChIKey is DKQIVUKDLNNDLA-TZMCWYRMSA-N. The full InChI is InChI=1S/C16H20N2O6S/c1-4-12-14(16(22)17(3)9-13(19)20)18(15(12)21)25(23,24)11-7-5-10(2)6-8-11/h5-8,12,14H,4,9H2,1-3H3,(H,19,20)/t12-,14-/m1/s1.
What are the key properties of 2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid?
2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid has a molecular weight of 368.41 g/mol, XLogP of 0.46, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2R,3R)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carbonyl]-methylamino]acetic acid is sourced from PubChem (CID 15934705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).